![[ICO]](/icons/blank.gif){kind=icon}
![[DIR]](/icons/back.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 2008_group_pic.jpg | 04-Jun-2008 17:16 | 51K | |
| EPSCoR Newsletter - October 2008[1].pdf | 13-Oct-2008 11:53 | 145K | |
| Field-assisted nanopatterning description[1].pdf | 14-Jan-2009 11:29 | 232K | |
| Fullerene-Acene Chemistries Description.pdf | 14-Jan-2009 11:29 | 555K | |
| Fullerene Nanotubes project description.pdf | 14-Jan-2009 11:30 | 916K | |
| Hydrogenated SWNTs Project Description.pdf | 14-Jan-2009 11:29 | 321K | |
| List of Recent Publications 2000-2009.pdf | 20-Feb-2009 14:59 | 878K | |
| NH EPSCoR Outreach Partnerships Poster[1].pdf | 13-Oct-2008 11:57 | 145K | |
| Polyamine Hydrogenation of Nanostructured Carbons.pdf | 14-Jan-2009 11:30 | 77K | |
| Substituent Effects in Pentacenes- Longest Lived Derivatives Revealed.pdf | 14-Jan-2009 11:38 | 308K | |
| WS_FTP.LOG | 20-Feb-2009 15:00 | 2.8K | |